C58H62N2 — CID 67991348
6,12-bis[5-tert-butyl-2-(4-tert-butylphenyl)phenyl]-3,9-dimethylquinolino[8,7-h]quinoline (PubChem CID 67991348) has the molecular formula C58H62N2 and a molecular weight of 787.15 g/mol. Its IUPAC name is 6,12-bis[5-tert-butyl-2-(4-tert-butylphenyl)phenyl]-3,9-dimethylquinolino[8,7-h]quinoline.
| Compound Name | 6,12-bis[5-tert-butyl-2-(4-tert-butylphenyl)phenyl]-3,9-dimethylquinolino[8,7-h]quinoline |
|---|---|
| PubChem CID | 67991348 |
| Molecular Formula | C58H62N2 |
| Molecular Weight | 787.15 g/mol |
| Exact Mass | 786.49 |
| IUPAC Name | 6,12-bis[5-tert-butyl-2-(4-tert-butylphenyl)phenyl]-3,9-dimethylquinolino[8,7-h]quinoline |
| SMILES | Cc1ccc2c(-c3cc(C(C)(C)C)ccc3-c3ccc(C(C)(C)C)cc3)cc3c(cc(-c4cc(C(C)(C)C)ccc4-c4ccc(C(C)(C)C)cc4)c4ccc(C)nc43)c2n1 |
| InChI | InChI=1S/C58H62N2/c1-35-15-27-45-49(47-31-41(57(9,10)11)25-29-43(47)37-17-21-39(22-18-37)55(3,4)5)34-52-51(53(45)59-35)33-50(46-28-16-36(2)60-54(46)52)48-32-42(58(12,13)14)26-30-44(48)38-19-23-40(24-20-38)56(6,7)8/h15-34H,1-14H3 |
| InChIKey | CMGRNGHYXHADPL-UHFFFAOYSA-N |
| XLogP | 16.41 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.15 |
| LogP ≤ 5 | 16.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|