C33H26N2 — CID 67991367
12-(9,9-dimethylfluoren-2-yl)-3,9-dimethylquinolino[8,7-h]quinoline (PubChem CID 67991367) has the molecular formula C33H26N2 and a molecular weight of 450.59 g/mol. Its IUPAC name is 12-(9,9-dimethylfluoren-2-yl)-3,9-dimethylquinolino[8,7-h]quinoline.
| Compound Name | 12-(9,9-dimethylfluoren-2-yl)-3,9-dimethylquinolino[8,7-h]quinoline |
|---|---|
| PubChem CID | 67991367 |
| Molecular Formula | C33H26N2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 12-(9,9-dimethylfluoren-2-yl)-3,9-dimethylquinolino[8,7-h]quinoline |
| SMILES | Cc1ccc2ccc3c(cc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4ccc(C)nc43)c2n1 |
| InChI | InChI=1S/C33H26N2/c1-19-9-11-21-12-16-26-28(31(21)34-19)18-27(25-14-10-20(2)35-32(25)26)22-13-15-24-23-7-5-6-8-29(23)33(3,4)30(24)17-22/h5-18H,1-4H3 |
| InChIKey | RQKORFHRPBIPPY-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|