C8H14N2 — CID 67991613
(2S)-N,N,2-trimethyl-2,3-dihydropyridin-6-amine (PubChem CID 67991613) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (2S)-N,N,2-trimethyl-2,3-dihydropyridin-6-amine.
| Compound Name | (2S)-N,N,2-trimethyl-2,3-dihydropyridin-6-amine |
|---|---|
| PubChem CID | 67991613 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (2S)-N,N,2-trimethyl-2,3-dihydropyridin-6-amine |
| SMILES | C[C@H]1CC=CC(N(C)C)=N1 |
| InChI | InChI=1S/C8H14N2/c1-7-5-4-6-8(9-7)10(2)3/h4,6-7H,5H2,1-3H3/t7-/m0/s1 |
| InChIKey | RCLPDWHJWNJEFI-ZETCQYMHSA-N |
| XLogP | 1.29 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |