About (3S)-6-fluoro-N,3-dimethylcyclohexa-1,5-dien-1-amine
(3S)-6-fluoro-N,3-dimethylcyclohexa-1,5-dien-1-amine (PubChem CID 67991642) has the molecular formula C8H12FN
and a molecular weight of 141.19 g/mol. Its IUPAC name is (3S)-6-fluoro-N,3-dimethylcyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | (3S)-6-fluoro-N,3-dimethylcyclohexa-1,5-dien-1-amine |
| PubChem CID | 67991642 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | (3S)-6-fluoro-N,3-dimethylcyclohexa-1,5-dien-1-amine |
| SMILES | CNC1=C[C@@H](C)CC=C1F |
| InChI | InChI=1S/C8H12FN/c1-6-3-4-7(9)8(5-6)10-2/h4-6,10H,3H2,1-2H3/t6-/m0/s1 |
| InChIKey | IVHIESYRDOJANR-LURJTMIESA-N |
| XLogP | 1.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S)-6-fluoro-N,3-dimethylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-6-fluoro-N,3-dimethylcyclohexa-1,5-dien-1-amine?
The IUPAC name of (3S)-6-fluoro-N,3-dimethylcyclohexa-1,5-dien-1-amine (CID 67991642) is (3S)-6-fluoro-N,3-dimethylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for (3S)-6-fluoro-N,3-dimethylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for (3S)-6-fluoro-N,3-dimethylcyclohexa-1,5-dien-1-amine is CNC1=C[C@@H](C)CC=C1F.
What is the InChIKey of (3S)-6-fluoro-N,3-dimethylcyclohexa-1,5-dien-1-amine?
The InChIKey is IVHIESYRDOJANR-LURJTMIESA-N. The full InChI is InChI=1S/C8H12FN/c1-6-3-4-7(9)8(5-6)10-2/h4-6,10H,3H2,1-2H3/t6-/m0/s1.
What are the key properties of (3S)-6-fluoro-N,3-dimethylcyclohexa-1,5-dien-1-amine?
(3S)-6-fluoro-N,3-dimethylcyclohexa-1,5-dien-1-amine has a molecular weight of 141.19 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-6-fluoro-N,3-dimethylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 67991642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).