About (2S)-N,N,2,4-tetramethyl-2,3-dihydropyridin-6-amine
(2S)-N,N,2,4-tetramethyl-2,3-dihydropyridin-6-amine (PubChem CID 67991657) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is (2S)-N,N,2,4-tetramethyl-2,3-dihydropyridin-6-amine.
Analyze (2S)-N,N,2,4-tetramethyl-2,3-dihydropyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,N,2,4-tetramethyl-2,3-dihydropyridin-6-amine?
The IUPAC name of (2S)-N,N,2,4-tetramethyl-2,3-dihydropyridin-6-amine (CID 67991657) is (2S)-N,N,2,4-tetramethyl-2,3-dihydropyridin-6-amine.
What is the SMILES notation for (2S)-N,N,2,4-tetramethyl-2,3-dihydropyridin-6-amine?
The canonical SMILES for (2S)-N,N,2,4-tetramethyl-2,3-dihydropyridin-6-amine is CC1=CC(N(C)C)=N[C@@H](C)C1.
What is the InChIKey of (2S)-N,N,2,4-tetramethyl-2,3-dihydropyridin-6-amine?
The InChIKey is CJBDJNHUSSGAPO-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H16N2/c1-7-5-8(2)10-9(6-7)11(3)4/h6,8H,5H2,1-4H3/t8-/m0/s1.
What are the key properties of (2S)-N,N,2,4-tetramethyl-2,3-dihydropyridin-6-amine?
(2S)-N,N,2,4-tetramethyl-2,3-dihydropyridin-6-amine has a molecular weight of 152.24 g/mol, XLogP of 1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,N,2,4-tetramethyl-2,3-dihydropyridin-6-amine is sourced from PubChem (CID 67991657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).