About (3S)-N,N,3-trimethyl-2,3-dihydropyrazin-2-amine
(3S)-N,N,3-trimethyl-2,3-dihydropyrazin-2-amine (PubChem CID 67991660) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is (3S)-N,N,3-trimethyl-2,3-dihydropyrazin-2-amine.
Molecular Properties
| Compound Name | (3S)-N,N,3-trimethyl-2,3-dihydropyrazin-2-amine |
| PubChem CID | 67991660 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | (3S)-N,N,3-trimethyl-2,3-dihydropyrazin-2-amine |
| SMILES | C[C@@H]1N=CC=NC1N(C)C |
| InChI | InChI=1S/C7H13N3/c1-6-7(10(2)3)9-5-4-8-6/h4-7H,1-3H3/t6-,7?/m0/s1 |
| InChIKey | ZYGWSDDUKLDUOO-PKPIPKONSA-N |
| XLogP | 0.42 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-N,N,3-trimethyl-2,3-dihydropyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N,N,3-trimethyl-2,3-dihydropyrazin-2-amine?
The IUPAC name of (3S)-N,N,3-trimethyl-2,3-dihydropyrazin-2-amine (CID 67991660) is (3S)-N,N,3-trimethyl-2,3-dihydropyrazin-2-amine.
What is the SMILES notation for (3S)-N,N,3-trimethyl-2,3-dihydropyrazin-2-amine?
The canonical SMILES for (3S)-N,N,3-trimethyl-2,3-dihydropyrazin-2-amine is C[C@@H]1N=CC=NC1N(C)C.
What is the InChIKey of (3S)-N,N,3-trimethyl-2,3-dihydropyrazin-2-amine?
The InChIKey is ZYGWSDDUKLDUOO-PKPIPKONSA-N. The full InChI is InChI=1S/C7H13N3/c1-6-7(10(2)3)9-5-4-8-6/h4-7H,1-3H3/t6-,7?/m0/s1.
What are the key properties of (3S)-N,N,3-trimethyl-2,3-dihydropyrazin-2-amine?
(3S)-N,N,3-trimethyl-2,3-dihydropyrazin-2-amine has a molecular weight of 139.20 g/mol, XLogP of 0.42, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N,N,3-trimethyl-2,3-dihydropyrazin-2-amine is sourced from PubChem (CID 67991660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).