About (2S)-N,N,2-trimethyl-2,3-dihydropyridin-3-amine
(2S)-N,N,2-trimethyl-2,3-dihydropyridin-3-amine (PubChem CID 67991661) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is (2S)-N,N,2-trimethyl-2,3-dihydropyridin-3-amine.
Molecular Properties
| Compound Name | (2S)-N,N,2-trimethyl-2,3-dihydropyridin-3-amine |
| PubChem CID | 67991661 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (2S)-N,N,2-trimethyl-2,3-dihydropyridin-3-amine |
| SMILES | C[C@@H]1N=CC=CC1N(C)C |
| InChI | InChI=1S/C8H14N2/c1-7-8(10(2)3)5-4-6-9-7/h4-8H,1-3H3/t7-,8?/m0/s1 |
| InChIKey | HBJJUBYFOLSHBN-JAMMHHFISA-N |
| XLogP | 0.95 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-N,N,2-trimethyl-2,3-dihydropyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,N,2-trimethyl-2,3-dihydropyridin-3-amine?
The IUPAC name of (2S)-N,N,2-trimethyl-2,3-dihydropyridin-3-amine (CID 67991661) is (2S)-N,N,2-trimethyl-2,3-dihydropyridin-3-amine.
What is the SMILES notation for (2S)-N,N,2-trimethyl-2,3-dihydropyridin-3-amine?
The canonical SMILES for (2S)-N,N,2-trimethyl-2,3-dihydropyridin-3-amine is C[C@@H]1N=CC=CC1N(C)C.
What is the InChIKey of (2S)-N,N,2-trimethyl-2,3-dihydropyridin-3-amine?
The InChIKey is HBJJUBYFOLSHBN-JAMMHHFISA-N. The full InChI is InChI=1S/C8H14N2/c1-7-8(10(2)3)5-4-6-9-7/h4-8H,1-3H3/t7-,8?/m0/s1.
What are the key properties of (2S)-N,N,2-trimethyl-2,3-dihydropyridin-3-amine?
(2S)-N,N,2-trimethyl-2,3-dihydropyridin-3-amine has a molecular weight of 138.21 g/mol, XLogP of 0.95, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,N,2-trimethyl-2,3-dihydropyridin-3-amine is sourced from PubChem (CID 67991661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).