C19H19ClF3NO3S2 — CID 67991867
N-[2-(2-chlorophenyl)sulfanylethyl]-2-methyl-2-[4-(trifluoromethyl)phenyl]sulfonylpropanamide (PubChem CID 67991867) has the molecular formula C19H19ClF3NO3S2 and a molecular weight of 465.95 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)sulfanylethyl]-2-methyl-2-[4-(trifluoromethyl)phenyl]sulfonylpropanamide.
| Compound Name | N-[2-(2-chlorophenyl)sulfanylethyl]-2-methyl-2-[4-(trifluoromethyl)phenyl]sulfonylpropanamide |
|---|---|
| PubChem CID | 67991867 |
| Molecular Formula | C19H19ClF3NO3S2 |
| Molecular Weight | 465.95 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | N-[2-(2-chlorophenyl)sulfanylethyl]-2-methyl-2-[4-(trifluoromethyl)phenyl]sulfonylpropanamide |
| SMILES | CC(C)(C(=O)NCCSc1ccccc1Cl)S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H19ClF3NO3S2/c1-18(2,17(25)24-11-12-28-16-6-4-3-5-15(16)20)29(26,27)14-9-7-13(8-10-14)19(21,22)23/h3-10H,11-12H2,1-2H3,(H,24,25) |
| InChIKey | HHJVAIYCMUZCIV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.95 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|