C21H27FN2O6 — CID 67992082
1-O-tert-butyl 2-O-ethyl 4-(4-fluoro-1,3-dihydroisoindole-2-carbonyl)oxypyrrolidine-1,2-dicarboxylate (PubChem CID 67992082) has the molecular formula C21H27FN2O6 and a molecular weight of 422.45 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl 4-(4-fluoro-1,3-dihydroisoindole-2-carbonyl)oxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl 4-(4-fluoro-1,3-dihydroisoindole-2-carbonyl)oxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 67992082 |
| Molecular Formula | C21H27FN2O6 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl 4-(4-fluoro-1,3-dihydroisoindole-2-carbonyl)oxypyrrolidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1CC(OC(=O)N2Cc3cccc(F)c3C2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H27FN2O6/c1-5-28-18(25)17-9-14(11-24(17)20(27)30-21(2,3)4)29-19(26)23-10-13-7-6-8-16(22)15(13)12-23/h6-8,14,17H,5,9-12H2,1-4H3 |
| InChIKey | PQPZFICOKXHTFL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|