C14H34OSi3 — CID 67992160
3,3,4,4,6,6-hexamethyl-2,2-di(propan-2-yl)oxatrisilinane (PubChem CID 67992160) has the molecular formula C14H34OSi3 and a molecular weight of 302.68 g/mol. Its IUPAC name is 3,3,4,4,6,6-hexamethyl-2,2-di(propan-2-yl)oxatrisilinane.
| Compound Name | 3,3,4,4,6,6-hexamethyl-2,2-di(propan-2-yl)oxatrisilinane |
|---|---|
| PubChem CID | 67992160 |
| Molecular Formula | C14H34OSi3 |
| Molecular Weight | 302.68 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 3,3,4,4,6,6-hexamethyl-2,2-di(propan-2-yl)oxatrisilinane |
| SMILES | CC(C)[Si]1(C(C)C)OC(C)(C)C[Si](C)(C)[Si]1(C)C |
| InChI | InChI=1S/C14H34OSi3/c1-12(2)18(13(3)4)15-14(5,6)11-16(7,8)17(18,9)10/h12-13H,11H2,1-10H3 |
| InChIKey | NIJVQNZRYBCSBG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.68 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|