C51H87N3O3 — CID 67992246
1-N,3-N,5-N-tris(2,4-ditert-butylcyclohexyl)benzene-1,3,5-tricarboxamide (PubChem CID 67992246) has the molecular formula C51H87N3O3 and a molecular weight of 790.27 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris(2,4-ditert-butylcyclohexyl)benzene-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,5-N-tris(2,4-ditert-butylcyclohexyl)benzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 67992246 |
| Molecular Formula | C51H87N3O3 |
| Molecular Weight | 790.27 g/mol |
| Exact Mass | 789.67 |
| IUPAC Name | 1-N,3-N,5-N-tris(2,4-ditert-butylcyclohexyl)benzene-1,3,5-tricarboxamide |
| SMILES | CC(C)(C)C1CCC(NC(=O)c2cc(C(=O)NC3CCC(C(C)(C)C)CC3C(C)(C)C)cc(C(=O)NC3CCC(C(C)(C)C)CC3C(C)(C)C)c2)C(C(C)(C)C)C1 |
| InChI | InChI=1S/C51H87N3O3/c1-46(2,3)34-19-22-40(37(28-34)49(10,11)12)52-43(55)31-25-32(44(56)53-41-23-20-35(47(4,5)6)29-38(41)50(13,14)15)27-33(26-31)45(57)54-42-24-21-36(48(7,8)9)30-39(42)51(16,17)18/h25-27,34-42H,19-24,28-30H2,1-18H3,(H,52,55)(H,53,56)(H,54,57) |
| InChIKey | CGYZFWOUJGNUGL-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.27 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |