About 2H-benzotriazole;iron
2H-benzotriazole;iron (PubChem CID 67992309) has the molecular formula C6H5FeN3
and a molecular weight of 174.97 g/mol. Its IUPAC name is 2H-benzotriazole;iron.
Molecular Properties
| Compound Name | 2H-benzotriazole;iron |
| PubChem CID | 67992309 |
| Molecular Formula | C6H5FeN3 |
| Molecular Weight | 174.97 g/mol |
| Exact Mass | 174.98 |
| IUPAC Name | 2H-benzotriazole;iron |
| SMILES | [Fe].c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C6H5N3.Fe/c1-2-4-6-5(3-1)7-9-8-6;/h1-4H,(H,7,8,9); |
| InChIKey | UDVCQFNQOYQWMG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.97 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2H-benzotriazole;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzotriazole;iron?
The IUPAC name of 2H-benzotriazole;iron (CID 67992309) is 2H-benzotriazole;iron.
What is the SMILES notation for 2H-benzotriazole;iron?
The canonical SMILES for 2H-benzotriazole;iron is [Fe].c1ccc2n[nH]nc2c1.
What is the InChIKey of 2H-benzotriazole;iron?
The InChIKey is UDVCQFNQOYQWMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3.Fe/c1-2-4-6-5(3-1)7-9-8-6;/h1-4H,(H,7,8,9);.
What are the key properties of 2H-benzotriazole;iron?
2H-benzotriazole;iron has a molecular weight of 174.97 g/mol, XLogP of 0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzotriazole;iron is sourced from PubChem (CID 67992309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).