C33H33N3O3 — CID 67992311
1-N,3-N,5-N-tris(3-ethylphenyl)benzene-1,3,5-tricarboxamide (PubChem CID 67992311) has the molecular formula C33H33N3O3 and a molecular weight of 519.65 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris(3-ethylphenyl)benzene-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,5-N-tris(3-ethylphenyl)benzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 67992311 |
| Molecular Formula | C33H33N3O3 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | 1-N,3-N,5-N-tris(3-ethylphenyl)benzene-1,3,5-tricarboxamide |
| SMILES | CCc1cccc(NC(=O)c2cc(C(=O)Nc3cccc(CC)c3)cc(C(=O)Nc3cccc(CC)c3)c2)c1 |
| InChI | InChI=1S/C33H33N3O3/c1-4-22-10-7-13-28(16-22)34-31(37)25-19-26(32(38)35-29-14-8-11-23(5-2)17-29)21-27(20-25)33(39)36-30-15-9-12-24(6-3)18-30/h7-21H,4-6H2,1-3H3,(H,34,37)(H,35,38)(H,36,39) |
| InChIKey | YPMQLTCYGOLTEI-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |