C17H12F3NO3 — CID 67992519
methyl 1-oxo-2-[4-(trifluoromethyl)phenyl]-3H-isoindole-4-carboxylate (PubChem CID 67992519) has the molecular formula C17H12F3NO3 and a molecular weight of 335.28 g/mol. Its IUPAC name is methyl 1-oxo-2-[4-(trifluoromethyl)phenyl]-3H-isoindole-4-carboxylate.
| Compound Name | methyl 1-oxo-2-[4-(trifluoromethyl)phenyl]-3H-isoindole-4-carboxylate |
|---|---|
| PubChem CID | 67992519 |
| Molecular Formula | C17H12F3NO3 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | methyl 1-oxo-2-[4-(trifluoromethyl)phenyl]-3H-isoindole-4-carboxylate |
| SMILES | COC(=O)c1cccc2c1CN(c1ccc(C(F)(F)F)cc1)C2=O |
| InChI | InChI=1S/C17H12F3NO3/c1-24-16(23)13-4-2-3-12-14(13)9-21(15(12)22)11-7-5-10(6-8-11)17(18,19)20/h2-8H,9H2,1H3 |
| InChIKey | WAWIOJIJXKFQDR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |