About 7-methylspiro[1,3-dihydronaphthalene-4,5'-bicyclo[2.2.1]hept-1-ene]-2-one
7-methylspiro[1,3-dihydronaphthalene-4,5'-bicyclo[2.2.1]hept-1-ene]-2-one (PubChem CID 67993558) has the molecular formula C17H18O
and a molecular weight of 238.33 g/mol. Its IUPAC name is 7-methylspiro[1,3-dihydronaphthalene-4,5'-bicyclo[2.2.1]hept-1-ene]-2-one.
Molecular Properties
| Compound Name | 7-methylspiro[1,3-dihydronaphthalene-4,5'-bicyclo[2.2.1]hept-1-ene]-2-one |
| PubChem CID | 67993558 |
| Molecular Formula | C17H18O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 7-methylspiro[1,3-dihydronaphthalene-4,5'-bicyclo[2.2.1]hept-1-ene]-2-one |
| SMILES | Cc1ccc2c(c1)CC(=O)CC21CC2=CCC1C2 |
| InChI | InChI=1S/C17H18O/c1-11-2-5-16-13(6-11)8-15(18)10-17(16)9-12-3-4-14(17)7-12/h2-3,5-6,14H,4,7-10H2,1H3 |
| InChIKey | PJAWETFVBCTOQV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-methylspiro[1,3-dihydronaphthalene-4,5'-bicyclo[2.2.1]hept-1-ene]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylspiro[1,3-dihydronaphthalene-4,5'-bicyclo[2.2.1]hept-1-ene]-2-one?
The IUPAC name of 7-methylspiro[1,3-dihydronaphthalene-4,5'-bicyclo[2.2.1]hept-1-ene]-2-one (CID 67993558) is 7-methylspiro[1,3-dihydronaphthalene-4,5'-bicyclo[2.2.1]hept-1-ene]-2-one.
What is the SMILES notation for 7-methylspiro[1,3-dihydronaphthalene-4,5'-bicyclo[2.2.1]hept-1-ene]-2-one?
The canonical SMILES for 7-methylspiro[1,3-dihydronaphthalene-4,5'-bicyclo[2.2.1]hept-1-ene]-2-one is Cc1ccc2c(c1)CC(=O)CC21CC2=CCC1C2.
What is the InChIKey of 7-methylspiro[1,3-dihydronaphthalene-4,5'-bicyclo[2.2.1]hept-1-ene]-2-one?
The InChIKey is PJAWETFVBCTOQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O/c1-11-2-5-16-13(6-11)8-15(18)10-17(16)9-12-3-4-14(17)7-12/h2-3,5-6,14H,4,7-10H2,1H3.
What are the key properties of 7-methylspiro[1,3-dihydronaphthalene-4,5'-bicyclo[2.2.1]hept-1-ene]-2-one?
7-methylspiro[1,3-dihydronaphthalene-4,5'-bicyclo[2.2.1]hept-1-ene]-2-one has a molecular weight of 238.33 g/mol, XLogP of 3.49, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylspiro[1,3-dihydronaphthalene-4,5'-bicyclo[2.2.1]hept-1-ene]-2-one is sourced from PubChem (CID 67993558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).