C16H16N2O — CID 67993582
3,3-dimethyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridin-2-one (PubChem CID 67993582) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is 3,3-dimethyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridin-2-one.
| Compound Name | 3,3-dimethyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 67993582 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 3,3-dimethyl-1-(4-methylphenyl)pyrrolo[2,3-b]pyridin-2-one |
| SMILES | Cc1ccc(N2C(=O)C(C)(C)c3cccnc32)cc1 |
| InChI | InChI=1S/C16H16N2O/c1-11-6-8-12(9-7-11)18-14-13(5-4-10-17-14)16(2,3)15(18)19/h4-10H,1-3H3 |
| InChIKey | DBMRWLZQIFHGJZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |