About spiro[6,8-dihydro-5H-anthracene-7,5'-bicyclo[2.2.1]hept-1-ene]-1-amine
spiro[6,8-dihydro-5H-anthracene-7,5'-bicyclo[2.2.1]hept-1-ene]-1-amine (PubChem CID 67993586) has the molecular formula C20H21N
and a molecular weight of 275.39 g/mol. Its IUPAC name is spiro[6,8-dihydro-5H-anthracene-7,5'-bicyclo[2.2.1]hept-1-ene]-1-amine.
Molecular Properties
| Compound Name | spiro[6,8-dihydro-5H-anthracene-7,5'-bicyclo[2.2.1]hept-1-ene]-1-amine |
| PubChem CID | 67993586 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | spiro[6,8-dihydro-5H-anthracene-7,5'-bicyclo[2.2.1]hept-1-ene]-1-amine |
| SMILES | Nc1cccc2cc3c(cc12)CC1(CC3)CC2=CCC1C2 |
| InChI | InChI=1S/C20H21N/c21-19-3-1-2-15-9-14-6-7-20(12-16(14)10-18(15)19)11-13-4-5-17(20)8-13/h1-4,9-10,17H,5-8,11-12,21H2 |
| InChIKey | JQTASOLCTHLNRR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze spiro[6,8-dihydro-5H-anthracene-7,5'-bicyclo[2.2.1]hept-1-ene]-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[6,8-dihydro-5H-anthracene-7,5'-bicyclo[2.2.1]hept-1-ene]-1-amine?
The IUPAC name of spiro[6,8-dihydro-5H-anthracene-7,5'-bicyclo[2.2.1]hept-1-ene]-1-amine (CID 67993586) is spiro[6,8-dihydro-5H-anthracene-7,5'-bicyclo[2.2.1]hept-1-ene]-1-amine.
What is the SMILES notation for spiro[6,8-dihydro-5H-anthracene-7,5'-bicyclo[2.2.1]hept-1-ene]-1-amine?
The canonical SMILES for spiro[6,8-dihydro-5H-anthracene-7,5'-bicyclo[2.2.1]hept-1-ene]-1-amine is Nc1cccc2cc3c(cc12)CC1(CC3)CC2=CCC1C2.
What is the InChIKey of spiro[6,8-dihydro-5H-anthracene-7,5'-bicyclo[2.2.1]hept-1-ene]-1-amine?
The InChIKey is JQTASOLCTHLNRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N/c21-19-3-1-2-15-9-14-6-7-20(12-16(14)10-18(15)19)11-13-4-5-17(20)8-13/h1-4,9-10,17H,5-8,11-12,21H2.
What are the key properties of spiro[6,8-dihydro-5H-anthracene-7,5'-bicyclo[2.2.1]hept-1-ene]-1-amine?
spiro[6,8-dihydro-5H-anthracene-7,5'-bicyclo[2.2.1]hept-1-ene]-1-amine has a molecular weight of 275.39 g/mol, XLogP of 4.64, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[6,8-dihydro-5H-anthracene-7,5'-bicyclo[2.2.1]hept-1-ene]-1-amine is sourced from PubChem (CID 67993586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).