C23H16N2O4S — CID 67994567
3-[3-[hydroxy-(2-methyl-1,1,4-trioxo-1λ6,2-benzothiazin-3-ylidene)methyl]phenyl]benzonitrile (PubChem CID 67994567) has the molecular formula C23H16N2O4S and a molecular weight of 416.46 g/mol. Its IUPAC name is 3-[3-[hydroxy-(2-methyl-1,1,4-trioxo-1λ6,2-benzothiazin-3-ylidene)methyl]phenyl]benzonitrile.
| Compound Name | 3-[3-[hydroxy-(2-methyl-1,1,4-trioxo-1λ6,2-benzothiazin-3-ylidene)methyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 67994567 |
| Molecular Formula | C23H16N2O4S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 3-[3-[hydroxy-(2-methyl-1,1,4-trioxo-1λ6,2-benzothiazin-3-ylidene)methyl]phenyl]benzonitrile |
| SMILES | CN1C(=C(O)c2cccc(-c3cccc(C#N)c3)c2)C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C23H16N2O4S/c1-25-21(23(27)19-10-2-3-11-20(19)30(25,28)29)22(26)18-9-5-8-17(13-18)16-7-4-6-15(12-16)14-24/h2-13,26H,1H3 |
| InChIKey | NMRNAZXYSWJBFI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|