C20H21NO4 — CID 67994643
4-[3-(2,5-dimethoxyphenyl)-3-oxoprop-1-enyl]-N,N-dimethylbenzamide (PubChem CID 67994643) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 4-[3-(2,5-dimethoxyphenyl)-3-oxoprop-1-enyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[3-(2,5-dimethoxyphenyl)-3-oxoprop-1-enyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 67994643 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 4-[3-(2,5-dimethoxyphenyl)-3-oxoprop-1-enyl]-N,N-dimethylbenzamide |
| SMILES | COc1ccc(OC)c(C(=O)C=Cc2ccc(C(=O)N(C)C)cc2)c1 |
| InChI | InChI=1S/C20H21NO4/c1-21(2)20(23)15-8-5-14(6-9-15)7-11-18(22)17-13-16(24-3)10-12-19(17)25-4/h5-13H,1-4H3 |
| InChIKey | DHISVIYAMRTOBB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|