About (4R)-4-(4-phenyl-1,3-thiazol-2-yl)-1-oxaspiro[4.5]decan-2-one
(4R)-4-(4-phenyl-1,3-thiazol-2-yl)-1-oxaspiro[4.5]decan-2-one (PubChem CID 679952) has the molecular formula C18H19NO2S
and a molecular weight of 313.42 g/mol. Its IUPAC name is (4R)-4-(4-phenyl-1,3-thiazol-2-yl)-1-oxaspiro[4.5]decan-2-one.
Molecular Properties
| Compound Name | (4R)-4-(4-phenyl-1,3-thiazol-2-yl)-1-oxaspiro[4.5]decan-2-one |
| PubChem CID | 679952 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (4R)-4-(4-phenyl-1,3-thiazol-2-yl)-1-oxaspiro[4.5]decan-2-one |
| SMILES | O=C1C[C@@H](c2nc(-c3ccccc3)cs2)C2(CCCCC2)O1 |
| InChI | InChI=1S/C18H19NO2S/c20-16-11-14(18(21-16)9-5-2-6-10-18)17-19-15(12-22-17)13-7-3-1-4-8-13/h1,3-4,7-8,12,14H,2,5-6,9-11H2/t14-/m0/s1 |
| InChIKey | FHESPGDKCTZMRK-AWEZNQCLSA-N |
| XLogP | 4.54 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4R)-4-(4-phenyl-1,3-thiazol-2-yl)-1-oxaspiro[4.5]decan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-(4-phenyl-1,3-thiazol-2-yl)-1-oxaspiro[4.5]decan-2-one?
The IUPAC name of (4R)-4-(4-phenyl-1,3-thiazol-2-yl)-1-oxaspiro[4.5]decan-2-one (CID 679952) is (4R)-4-(4-phenyl-1,3-thiazol-2-yl)-1-oxaspiro[4.5]decan-2-one.
What is the SMILES notation for (4R)-4-(4-phenyl-1,3-thiazol-2-yl)-1-oxaspiro[4.5]decan-2-one?
The canonical SMILES for (4R)-4-(4-phenyl-1,3-thiazol-2-yl)-1-oxaspiro[4.5]decan-2-one is O=C1C[C@@H](c2nc(-c3ccccc3)cs2)C2(CCCCC2)O1.
What is the InChIKey of (4R)-4-(4-phenyl-1,3-thiazol-2-yl)-1-oxaspiro[4.5]decan-2-one?
The InChIKey is FHESPGDKCTZMRK-AWEZNQCLSA-N. The full InChI is InChI=1S/C18H19NO2S/c20-16-11-14(18(21-16)9-5-2-6-10-18)17-19-15(12-22-17)13-7-3-1-4-8-13/h1,3-4,7-8,12,14H,2,5-6,9-11H2/t14-/m0/s1.
What are the key properties of (4R)-4-(4-phenyl-1,3-thiazol-2-yl)-1-oxaspiro[4.5]decan-2-one?
(4R)-4-(4-phenyl-1,3-thiazol-2-yl)-1-oxaspiro[4.5]decan-2-one has a molecular weight of 313.42 g/mol, XLogP of 4.54, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-(4-phenyl-1,3-thiazol-2-yl)-1-oxaspiro[4.5]decan-2-one is sourced from PubChem (CID 679952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).