C21H22FN7O2 — CID 67995336
2-N-[2-(3-fluoropiperazin-1-yl)phenyl]-3-nitro-6-N-(pyridin-3-ylmethyl)pyridine-2,6-diamine (PubChem CID 67995336) has the molecular formula C21H22FN7O2 and a molecular weight of 423.45 g/mol. Its IUPAC name is 2-N-[2-(3-fluoropiperazin-1-yl)phenyl]-3-nitro-6-N-(pyridin-3-ylmethyl)pyridine-2,6-diamine.
| Compound Name | 2-N-[2-(3-fluoropiperazin-1-yl)phenyl]-3-nitro-6-N-(pyridin-3-ylmethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 67995336 |
| Molecular Formula | C21H22FN7O2 |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-N-[2-(3-fluoropiperazin-1-yl)phenyl]-3-nitro-6-N-(pyridin-3-ylmethyl)pyridine-2,6-diamine |
| SMILES | O=[N+]([O-])c1ccc(NCc2cccnc2)nc1Nc1ccccc1N1CCNC(F)C1 |
| InChI | InChI=1S/C21H22FN7O2/c22-19-14-28(11-10-24-19)17-6-2-1-5-16(17)26-21-18(29(30)31)7-8-20(27-21)25-13-15-4-3-9-23-12-15/h1-9,12,19,24H,10-11,13-14H2,(H2,25,26,27) |
| InChIKey | SQFNEMYFCFAWOS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|