C21H26N6O2S — CID 67995355
2-N-[4-[2-(dipropylamino)-1,3-thiazol-4-yl]phenyl]-6-N-methyl-3-nitropyridine-2,6-diamine (PubChem CID 67995355) has the molecular formula C21H26N6O2S and a molecular weight of 426.55 g/mol. Its IUPAC name is 2-N-[4-[2-(dipropylamino)-1,3-thiazol-4-yl]phenyl]-6-N-methyl-3-nitropyridine-2,6-diamine.
| Compound Name | 2-N-[4-[2-(dipropylamino)-1,3-thiazol-4-yl]phenyl]-6-N-methyl-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 67995355 |
| Molecular Formula | C21H26N6O2S |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-N-[4-[2-(dipropylamino)-1,3-thiazol-4-yl]phenyl]-6-N-methyl-3-nitropyridine-2,6-diamine |
| SMILES | CCCN(CCC)c1nc(-c2ccc(Nc3nc(NC)ccc3[N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C21H26N6O2S/c1-4-12-26(13-5-2)21-24-17(14-30-21)15-6-8-16(9-7-15)23-20-18(27(28)29)10-11-19(22-3)25-20/h6-11,14H,4-5,12-13H2,1-3H3,(H2,22,23,25) |
| InChIKey | CTBMRFAHIJUBGC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|