About [3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamic acid
[3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamic acid (PubChem CID 67995366) has the molecular formula C15H17FN2O4
and a molecular weight of 308.31 g/mol. Its IUPAC name is [3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamic acid.
Molecular Properties
| Compound Name | [3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamic acid |
| PubChem CID | 67995366 |
| Molecular Formula | C15H17FN2O4 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | [3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamic acid |
| SMILES | O=C(O)NC1CC(Oc2ncc(F)cc2C2=CCOCC2)C1 |
| InChI | InChI=1S/C15H17FN2O4/c16-10-5-13(9-1-3-21-4-2-9)14(17-8-10)22-12-6-11(7-12)18-15(19)20/h1,5,8,11-12,18H,2-4,6-7H2,(H,19,20) |
| InChIKey | ZCZSAEPURIUXRY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamic acid?
The IUPAC name of [3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamic acid (CID 67995366) is [3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamic acid.
What is the SMILES notation for [3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamic acid?
The canonical SMILES for [3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamic acid is O=C(O)NC1CC(Oc2ncc(F)cc2C2=CCOCC2)C1.
What is the InChIKey of [3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamic acid?
The InChIKey is ZCZSAEPURIUXRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17FN2O4/c16-10-5-13(9-1-3-21-4-2-9)14(17-8-10)22-12-6-11(7-12)18-15(19)20/h1,5,8,11-12,18H,2-4,6-7H2,(H,19,20).
What are the key properties of [3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamic acid?
[3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamic acid has a molecular weight of 308.31 g/mol, XLogP of 2.20, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[3-(3,6-dihydro-2H-pyran-4-yl)-5-fluoro-2-pyridinyl]oxy]cyclobutyl]carbamic acid is sourced from PubChem (CID 67995366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).