About 1-[6-(3,4-difluoroanilino)-5-nitro-2-pyridinyl]piperidin-4-ol
1-[6-(3,4-difluoroanilino)-5-nitro-2-pyridinyl]piperidin-4-ol (PubChem CID 67995460) has the molecular formula C16H16F2N4O3
and a molecular weight of 350.33 g/mol. Its IUPAC name is 1-[6-(3,4-difluoroanilino)-5-nitro-2-pyridinyl]piperidin-4-ol.
Molecular Properties
| Compound Name | 1-[6-(3,4-difluoroanilino)-5-nitro-2-pyridinyl]piperidin-4-ol |
| PubChem CID | 67995460 |
| Molecular Formula | C16H16F2N4O3 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 1-[6-(3,4-difluoroanilino)-5-nitro-2-pyridinyl]piperidin-4-ol |
| SMILES | O=[N+]([O-])c1ccc(N2CCC(O)CC2)nc1Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H16F2N4O3/c17-12-2-1-10(9-13(12)18)19-16-14(22(24)25)3-4-15(20-16)21-7-5-11(23)6-8-21/h1-4,9,11,23H,5-8H2,(H,19,20) |
| InChIKey | XFEFMIXFTHTAMT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 91.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-(3,4-difluoroanilino)-5-nitro-2-pyridinyl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(3,4-difluoroanilino)-5-nitro-2-pyridinyl]piperidin-4-ol?
The IUPAC name of 1-[6-(3,4-difluoroanilino)-5-nitro-2-pyridinyl]piperidin-4-ol (CID 67995460) is 1-[6-(3,4-difluoroanilino)-5-nitro-2-pyridinyl]piperidin-4-ol.
What is the SMILES notation for 1-[6-(3,4-difluoroanilino)-5-nitro-2-pyridinyl]piperidin-4-ol?
The canonical SMILES for 1-[6-(3,4-difluoroanilino)-5-nitro-2-pyridinyl]piperidin-4-ol is O=[N+]([O-])c1ccc(N2CCC(O)CC2)nc1Nc1ccc(F)c(F)c1.
What is the InChIKey of 1-[6-(3,4-difluoroanilino)-5-nitro-2-pyridinyl]piperidin-4-ol?
The InChIKey is XFEFMIXFTHTAMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F2N4O3/c17-12-2-1-10(9-13(12)18)19-16-14(22(24)25)3-4-15(20-16)21-7-5-11(23)6-8-21/h1-4,9,11,23H,5-8H2,(H,19,20).
What are the key properties of 1-[6-(3,4-difluoroanilino)-5-nitro-2-pyridinyl]piperidin-4-ol?
1-[6-(3,4-difluoroanilino)-5-nitro-2-pyridinyl]piperidin-4-ol has a molecular weight of 350.33 g/mol, XLogP of 2.97, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(3,4-difluoroanilino)-5-nitro-2-pyridinyl]piperidin-4-ol is sourced from PubChem (CID 67995460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).