About 4-[(1S)-1-(2,9-dioxo-1-oxa-3-azaspiro[5.5]undecan-3-yl)ethyl]benzonitrile
4-[(1S)-1-(2,9-dioxo-1-oxa-3-azaspiro[5.5]undecan-3-yl)ethyl]benzonitrile (PubChem CID 67996452) has the molecular formula C18H20N2O3
and a molecular weight of 312.37 g/mol. Its IUPAC name is 4-[(1S)-1-(2,9-dioxo-1-oxa-3-azaspiro[5.5]undecan-3-yl)ethyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[(1S)-1-(2,9-dioxo-1-oxa-3-azaspiro[5.5]undecan-3-yl)ethyl]benzonitrile |
| PubChem CID | 67996452 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 4-[(1S)-1-(2,9-dioxo-1-oxa-3-azaspiro[5.5]undecan-3-yl)ethyl]benzonitrile |
| SMILES | C[C@@H](c1ccc(C#N)cc1)N1CCC2(CCC(=O)CC2)OC1=O |
| InChI | InChI=1S/C18H20N2O3/c1-13(15-4-2-14(12-19)3-5-15)20-11-10-18(23-17(20)22)8-6-16(21)7-9-18/h2-5,13H,6-11H2,1H3/t13-/m0/s1 |
| InChIKey | UQPZYQOCGNLDMA-ZDUSSCGKSA-N |
| XLogP | 3.34 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(1S)-1-(2,9-dioxo-1-oxa-3-azaspiro[5.5]undecan-3-yl)ethyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1S)-1-(2,9-dioxo-1-oxa-3-azaspiro[5.5]undecan-3-yl)ethyl]benzonitrile?
The IUPAC name of 4-[(1S)-1-(2,9-dioxo-1-oxa-3-azaspiro[5.5]undecan-3-yl)ethyl]benzonitrile (CID 67996452) is 4-[(1S)-1-(2,9-dioxo-1-oxa-3-azaspiro[5.5]undecan-3-yl)ethyl]benzonitrile.
What is the SMILES notation for 4-[(1S)-1-(2,9-dioxo-1-oxa-3-azaspiro[5.5]undecan-3-yl)ethyl]benzonitrile?
The canonical SMILES for 4-[(1S)-1-(2,9-dioxo-1-oxa-3-azaspiro[5.5]undecan-3-yl)ethyl]benzonitrile is C[C@@H](c1ccc(C#N)cc1)N1CCC2(CCC(=O)CC2)OC1=O.
What is the InChIKey of 4-[(1S)-1-(2,9-dioxo-1-oxa-3-azaspiro[5.5]undecan-3-yl)ethyl]benzonitrile?
The InChIKey is UQPZYQOCGNLDMA-ZDUSSCGKSA-N. The full InChI is InChI=1S/C18H20N2O3/c1-13(15-4-2-14(12-19)3-5-15)20-11-10-18(23-17(20)22)8-6-16(21)7-9-18/h2-5,13H,6-11H2,1H3/t13-/m0/s1.
What are the key properties of 4-[(1S)-1-(2,9-dioxo-1-oxa-3-azaspiro[5.5]undecan-3-yl)ethyl]benzonitrile?
4-[(1S)-1-(2,9-dioxo-1-oxa-3-azaspiro[5.5]undecan-3-yl)ethyl]benzonitrile has a molecular weight of 312.37 g/mol, XLogP of 3.34, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1S)-1-(2,9-dioxo-1-oxa-3-azaspiro[5.5]undecan-3-yl)ethyl]benzonitrile is sourced from PubChem (CID 67996452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).