About azane;2-methylpyridin-3-amine
azane;2-methylpyridin-3-amine (PubChem CID 67996717) has the molecular formula C6H11N3
and a molecular weight of 125.17 g/mol. Its IUPAC name is azane;2-methylpyridin-3-amine.
Molecular Properties
| Compound Name | azane;2-methylpyridin-3-amine |
| PubChem CID | 67996717 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | azane;2-methylpyridin-3-amine |
| SMILES | Cc1ncccc1N.N |
| InChI | InChI=1S/C6H8N2.H3N/c1-5-6(7)3-2-4-8-5;/h2-4H,7H2,1H3;1H3 |
| InChIKey | CYHXNWBGPLRLQV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;2-methylpyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-methylpyridin-3-amine?
The IUPAC name of azane;2-methylpyridin-3-amine (CID 67996717) is azane;2-methylpyridin-3-amine.
What is the SMILES notation for azane;2-methylpyridin-3-amine?
The canonical SMILES for azane;2-methylpyridin-3-amine is Cc1ncccc1N.N.
What is the InChIKey of azane;2-methylpyridin-3-amine?
The InChIKey is CYHXNWBGPLRLQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.H3N/c1-5-6(7)3-2-4-8-5;/h2-4H,7H2,1H3;1H3.
What are the key properties of azane;2-methylpyridin-3-amine?
azane;2-methylpyridin-3-amine has a molecular weight of 125.17 g/mol, XLogP of 1.13, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-methylpyridin-3-amine is sourced from PubChem (CID 67996717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).