C18H23F2NO3 — CID 67996763
3-[(1S)-1-[4-(difluoromethyl)phenyl]ethyl]-9-hydroxy-1-oxa-3-azaspiro[5.5]undecan-2-one (PubChem CID 67996763) has the molecular formula C18H23F2NO3 and a molecular weight of 339.38 g/mol. Its IUPAC name is 3-[(1S)-1-[4-(difluoromethyl)phenyl]ethyl]-9-hydroxy-1-oxa-3-azaspiro[5.5]undecan-2-one.
| Compound Name | 3-[(1S)-1-[4-(difluoromethyl)phenyl]ethyl]-9-hydroxy-1-oxa-3-azaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 67996763 |
| Molecular Formula | C18H23F2NO3 |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 3-[(1S)-1-[4-(difluoromethyl)phenyl]ethyl]-9-hydroxy-1-oxa-3-azaspiro[5.5]undecan-2-one |
| SMILES | C[C@@H](c1ccc(C(F)F)cc1)N1CCC2(CCC(O)CC2)OC1=O |
| InChI | InChI=1S/C18H23F2NO3/c1-12(13-2-4-14(5-3-13)16(19)20)21-11-10-18(24-17(21)23)8-6-15(22)7-9-18/h2-5,12,15-16,22H,6-11H2,1H3/t12-,15?,18?/m0/s1 |
| InChIKey | NHRGOCYEWILMIK-RTYYOJRZSA-N |
| XLogP | 4.20 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |