C26H27FN2O — CID 67997503
N,N-diethyl-2-[5-[4-(4-fluorophenoxy)phenyl]indol-1-yl]ethanamine (PubChem CID 67997503) has the molecular formula C26H27FN2O and a molecular weight of 402.51 g/mol. Its IUPAC name is N,N-diethyl-2-[5-[4-(4-fluorophenoxy)phenyl]indol-1-yl]ethanamine.
| Compound Name | N,N-diethyl-2-[5-[4-(4-fluorophenoxy)phenyl]indol-1-yl]ethanamine |
|---|---|
| PubChem CID | 67997503 |
| Molecular Formula | C26H27FN2O |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N,N-diethyl-2-[5-[4-(4-fluorophenoxy)phenyl]indol-1-yl]ethanamine |
| SMILES | CCN(CC)CCn1ccc2cc(-c3ccc(Oc4ccc(F)cc4)cc3)ccc21 |
| InChI | InChI=1S/C26H27FN2O/c1-3-28(4-2)17-18-29-16-15-22-19-21(7-14-26(22)29)20-5-10-24(11-6-20)30-25-12-8-23(27)9-13-25/h5-16,19H,3-4,17-18H2,1-2H3 |
| InChIKey | KTMYZIRMTGDPOB-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |