C25H23FN6O2S — CID 67997985
4-fluoro-N-[(1R,3R)-3-[5-(4-methylphenyl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]aniline (PubChem CID 67997985) has the molecular formula C25H23FN6O2S and a molecular weight of 490.56 g/mol. Its IUPAC name is 4-fluoro-N-[(1R,3R)-3-[5-(4-methylphenyl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]aniline.
| Compound Name | 4-fluoro-N-[(1R,3R)-3-[5-(4-methylphenyl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]aniline |
|---|---|
| PubChem CID | 67997985 |
| Molecular Formula | C25H23FN6O2S |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 4-fluoro-N-[(1R,3R)-3-[5-(4-methylphenyl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]aniline |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c2ncc2nnc([C@@H]4CC[C@@H](Nc5ccc(F)cc5)C4)n23)cc1 |
| InChI | InChI=1S/C25H23FN6O2S/c1-16-2-10-21(11-3-16)35(33,34)31-13-12-22-25(31)27-15-23-29-30-24(32(22)23)17-4-7-20(14-17)28-19-8-5-18(26)6-9-19/h2-3,5-6,8-13,15,17,20,28H,4,7,14H2,1H3/t17-,20-/m1/s1 |
| InChIKey | MJNXMISAMKVCHX-YLJYHZDGSA-N |
| XLogP | 4.51 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |