About pyrrole-2,5-dione;sulfur monoxide
pyrrole-2,5-dione;sulfur monoxide (PubChem CID 67998001) has the molecular formula C4H3NO3S
and a molecular weight of 145.14 g/mol. Its IUPAC name is pyrrole-2,5-dione;sulfur monoxide.
Molecular Properties
| Compound Name | pyrrole-2,5-dione;sulfur monoxide |
| PubChem CID | 67998001 |
| Molecular Formula | C4H3NO3S |
| Molecular Weight | 145.14 g/mol |
| Exact Mass | 144.98 |
| IUPAC Name | pyrrole-2,5-dione;sulfur monoxide |
| SMILES | O=C1C=CC(=O)N1.O=S |
| InChI | InChI=1S/C4H3NO2.OS/c6-3-1-2-4(7)5-3;1-2/h1-2H,(H,5,6,7); |
| InChIKey | KRRDHAKLZNQEDD-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.14 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze pyrrole-2,5-dione;sulfur monoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrole-2,5-dione;sulfur monoxide?
The IUPAC name of pyrrole-2,5-dione;sulfur monoxide (CID 67998001) is pyrrole-2,5-dione;sulfur monoxide.
What is the SMILES notation for pyrrole-2,5-dione;sulfur monoxide?
The canonical SMILES for pyrrole-2,5-dione;sulfur monoxide is O=C1C=CC(=O)N1.O=S.
What is the InChIKey of pyrrole-2,5-dione;sulfur monoxide?
The InChIKey is KRRDHAKLZNQEDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO2.OS/c6-3-1-2-4(7)5-3;1-2/h1-2H,(H,5,6,7);.
What are the key properties of pyrrole-2,5-dione;sulfur monoxide?
pyrrole-2,5-dione;sulfur monoxide has a molecular weight of 145.14 g/mol, XLogP of -1.14, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrole-2,5-dione;sulfur monoxide is sourced from PubChem (CID 67998001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).