C24H29N5O6S2 — CID 67998126
N-[(1S,3R,4S)-3-ethyl-4-[[1-(4-methylphenyl)sulfonyl-5-nitropyrrolo[2,3-b]pyridin-4-yl]amino]cyclopentyl]cyclopropanesulfonamide (PubChem CID 67998126) has the molecular formula C24H29N5O6S2 and a molecular weight of 547.66 g/mol. Its IUPAC name is N-[(1S,3R,4S)-3-ethyl-4-[[1-(4-methylphenyl)sulfonyl-5-nitropyrrolo[2,3-b]pyridin-4-yl]amino]cyclopentyl]cyclopropanesulfonamide.
| Compound Name | N-[(1S,3R,4S)-3-ethyl-4-[[1-(4-methylphenyl)sulfonyl-5-nitropyrrolo[2,3-b]pyridin-4-yl]amino]cyclopentyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 67998126 |
| Molecular Formula | C24H29N5O6S2 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | N-[(1S,3R,4S)-3-ethyl-4-[[1-(4-methylphenyl)sulfonyl-5-nitropyrrolo[2,3-b]pyridin-4-yl]amino]cyclopentyl]cyclopropanesulfonamide |
| SMILES | CC[C@@H]1C[C@H](NS(=O)(=O)C2CC2)C[C@@H]1Nc1c([N+](=O)[O-])cnc2c1ccn2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H29N5O6S2/c1-3-16-12-17(27-36(32,33)18-8-9-18)13-21(16)26-23-20-10-11-28(24(20)25-14-22(23)29(30)31)37(34,35)19-6-4-15(2)5-7-19/h4-7,10-11,14,16-18,21,27H,3,8-9,12-13H2,1-2H3,(H,25,26)/t16-,17+,21+/m1/s1 |
| InChIKey | GBNDTUVBORMPLS-WWMYMODYSA-N |
| XLogP | 3.54 |
| TPSA | 153.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|