C26H26N4O2 — CID 67998342
3-[1-(4-methoxyphenyl)-5-pyridin-3-ylpyrazol-3-yl]-N-[(3-methylphenyl)methyl]propanamide (PubChem CID 67998342) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 3-[1-(4-methoxyphenyl)-5-pyridin-3-ylpyrazol-3-yl]-N-[(3-methylphenyl)methyl]propanamide.
| Compound Name | 3-[1-(4-methoxyphenyl)-5-pyridin-3-ylpyrazol-3-yl]-N-[(3-methylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 67998342 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 3-[1-(4-methoxyphenyl)-5-pyridin-3-ylpyrazol-3-yl]-N-[(3-methylphenyl)methyl]propanamide |
| SMILES | COc1ccc(-n2nc(CCC(=O)NCc3cccc(C)c3)cc2-c2cccnc2)cc1 |
| InChI | InChI=1S/C26H26N4O2/c1-19-5-3-6-20(15-19)17-28-26(31)13-8-22-16-25(21-7-4-14-27-18-21)30(29-22)23-9-11-24(32-2)12-10-23/h3-7,9-12,14-16,18H,8,13,17H2,1-2H3,(H,28,31) |
| InChIKey | REIMVGIMURVHRH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |