C16H18F3N5 — CID 67998488
(1S,3R,4R)-3-ethyl-4-[10-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentan-1-amine (PubChem CID 67998488) has the molecular formula C16H18F3N5 and a molecular weight of 337.35 g/mol. Its IUPAC name is (1S,3R,4R)-3-ethyl-4-[10-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentan-1-amine.
| Compound Name | (1S,3R,4R)-3-ethyl-4-[10-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 67998488 |
| Molecular Formula | C16H18F3N5 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (1S,3R,4R)-3-ethyl-4-[10-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentan-1-amine |
| SMILES | CC[C@@H]1C[C@H](N)C[C@H]1c1nc(C(F)(F)F)c2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C16H18F3N5/c1-2-8-5-9(20)6-10(8)15-23-13(16(17,18)19)12-7-22-14-11(24(12)15)3-4-21-14/h3-4,7-10,21H,2,5-6,20H2,1H3/t8-,9+,10-/m1/s1 |
| InChIKey | PTWVZOXQOPSQIG-KXUCPTDWSA-N |
| XLogP | 3.46 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |