About 2-(7H-purin-8-yl)-1,3-thiazole
2-(7H-purin-8-yl)-1,3-thiazole (PubChem CID 67998499) has the molecular formula C8H5N5S
and a molecular weight of 203.23 g/mol. Its IUPAC name is 2-(7H-purin-8-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(7H-purin-8-yl)-1,3-thiazole |
| PubChem CID | 67998499 |
| Molecular Formula | C8H5N5S |
| Molecular Weight | 203.23 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 2-(7H-purin-8-yl)-1,3-thiazole |
| SMILES | c1csc(-c2nc3ncncc3[nH]2)n1 |
| InChI | InChI=1S/C8H5N5S/c1-2-14-8(10-1)7-12-5-3-9-4-11-6(5)13-7/h1-4H,(H,9,11,12,13) |
| InChIKey | HBTARXJIYHBGGO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(7H-purin-8-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7H-purin-8-yl)-1,3-thiazole?
The IUPAC name of 2-(7H-purin-8-yl)-1,3-thiazole (CID 67998499) is 2-(7H-purin-8-yl)-1,3-thiazole.
What is the SMILES notation for 2-(7H-purin-8-yl)-1,3-thiazole?
The canonical SMILES for 2-(7H-purin-8-yl)-1,3-thiazole is c1csc(-c2nc3ncncc3[nH]2)n1.
What is the InChIKey of 2-(7H-purin-8-yl)-1,3-thiazole?
The InChIKey is HBTARXJIYHBGGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N5S/c1-2-14-8(10-1)7-12-5-3-9-4-11-6(5)13-7/h1-4H,(H,9,11,12,13).
What are the key properties of 2-(7H-purin-8-yl)-1,3-thiazole?
2-(7H-purin-8-yl)-1,3-thiazole has a molecular weight of 203.23 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7H-purin-8-yl)-1,3-thiazole is sourced from PubChem (CID 67998499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).