C28H34Cl2N2O5S — CID 67998982
2-[(3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(2S)-1-(1,1-dioxo-1,4-thiazinan-4-yl)butan-2-yl]-3-methyl-2-oxopiperidin-3-yl]acetic acid (PubChem CID 67998982) has the molecular formula C28H34Cl2N2O5S and a molecular weight of 581.56 g/mol. Its IUPAC name is 2-[(3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(2S)-1-(1,1-dioxo-1,4-thiazinan-4-yl)butan-2-yl]-3-methyl-2-oxopiperidin-3-yl]acetic acid.
| Compound Name | 2-[(3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(2S)-1-(1,1-dioxo-1,4-thiazinan-4-yl)butan-2-yl]-3-methyl-2-oxopiperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 67998982 |
| Molecular Formula | C28H34Cl2N2O5S |
| Molecular Weight | 581.56 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | 2-[(3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(2S)-1-(1,1-dioxo-1,4-thiazinan-4-yl)butan-2-yl]-3-methyl-2-oxopiperidin-3-yl]acetic acid |
| SMILES | CC[C@@H](CN1CCS(=O)(=O)CC1)N1C(=O)[C@](C)(CC(=O)O)C[C@H](c2cccc(Cl)c2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H34Cl2N2O5S/c1-3-23(18-31-11-13-38(36,37)14-12-31)32-26(19-7-9-21(29)10-8-19)24(20-5-4-6-22(30)15-20)16-28(2,27(32)35)17-25(33)34/h4-10,15,23-24,26H,3,11-14,16-18H2,1-2H3,(H,33,34)/t23-,24+,26+,28-/m0/s1 |
| InChIKey | SUGBUBYMNBJFHX-PAXQOXJBSA-N |
| XLogP | 5.04 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |