C27H25N9O2S — CID 67999532
5-(4-methylphenyl)sulfonyl-3-[2-(4-methylpiperazin-1-yl)quinazolin-4-yl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 67999532) has the molecular formula C27H25N9O2S and a molecular weight of 539.63 g/mol. Its IUPAC name is 5-(4-methylphenyl)sulfonyl-3-[2-(4-methylpiperazin-1-yl)quinazolin-4-yl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 5-(4-methylphenyl)sulfonyl-3-[2-(4-methylpiperazin-1-yl)quinazolin-4-yl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 67999532 |
| Molecular Formula | C27H25N9O2S |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | 5-(4-methylphenyl)sulfonyl-3-[2-(4-methylpiperazin-1-yl)quinazolin-4-yl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3nc(N4CCN(C)CC4)nc4ccccc34)c3c2ncc2nncn23)cc1 |
| InChI | InChI=1S/C27H25N9O2S/c1-18-7-9-19(10-8-18)39(37,38)36-16-21(25-26(36)28-15-23-32-29-17-35(23)25)24-20-5-3-4-6-22(20)30-27(31-24)34-13-11-33(2)12-14-34/h3-10,15-17H,11-14H2,1-2H3 |
| InChIKey | WLDLCNDUFHUATN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 114.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |