C31H35Cl2N3O5 — CID 67999548
2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(1S)-1-cyclopropyl-2-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)ethyl]-3-methyl-2-oxopiperidin-3-yl]acetic acid (PubChem CID 67999548) has the molecular formula C31H35Cl2N3O5 and a molecular weight of 600.54 g/mol. Its IUPAC name is 2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(1S)-1-cyclopropyl-2-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)ethyl]-3-methyl-2-oxopiperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(1S)-1-cyclopropyl-2-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)ethyl]-3-methyl-2-oxopiperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 67999548 |
| Molecular Formula | C31H35Cl2N3O5 |
| Molecular Weight | 600.54 g/mol |
| Exact Mass | 599.20 |
| IUPAC Name | 2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(1S)-1-cyclopropyl-2-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)ethyl]-3-methyl-2-oxopiperidin-3-yl]acetic acid |
| SMILES | CN1C(=O)N(C[C@H](C2CC2)N2C(=O)[C@@](C)(CC(=O)O)C[C@H](c3cccc(Cl)c3)[C@H]2c2ccc(Cl)cc2)C(=O)C1(C)C |
| InChI | InChI=1S/C31H35Cl2N3O5/c1-30(2)27(39)35(29(41)34(30)4)17-24(18-8-9-18)36-26(19-10-12-21(32)13-11-19)23(20-6-5-7-22(33)14-20)15-31(3,28(36)40)16-25(37)38/h5-7,10-14,18,23-24,26H,8-9,15-17H2,1-4H3,(H,37,38)/t23-,24-,26-,31-/m1/s1 |
| InChIKey | WJOQNXHUFMKXHU-JCAGLCPKSA-N |
| XLogP | 5.98 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.54 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|