C18H20F3N5O — CID 67999575
(1S,3R,4S)-3-ethyl-4-[10-(2,2,2-trifluoroethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentane-1-carboxamide (PubChem CID 67999575) has the molecular formula C18H20F3N5O and a molecular weight of 379.39 g/mol. Its IUPAC name is (1S,3R,4S)-3-ethyl-4-[10-(2,2,2-trifluoroethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentane-1-carboxamide.
| Compound Name | (1S,3R,4S)-3-ethyl-4-[10-(2,2,2-trifluoroethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 67999575 |
| Molecular Formula | C18H20F3N5O |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (1S,3R,4S)-3-ethyl-4-[10-(2,2,2-trifluoroethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentane-1-carboxamide |
| SMILES | CC[C@@H]1C[C@H](C(N)=O)C[C@@H]1c1nc(CC(F)(F)F)c2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C18H20F3N5O/c1-2-9-5-10(15(22)27)6-11(9)17-25-12(7-18(19,20)21)14-8-24-16-13(26(14)17)3-4-23-16/h3-4,8-11,23H,2,5-7H2,1H3,(H2,22,27)/t9-,10+,11+/m1/s1 |
| InChIKey | ZBZNDMKQFFGYQD-VWYCJHECSA-N |
| XLogP | 3.32 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |