C15H18N6O4 — CID 6800682
1-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)hexane-2,3,4,5-tetrol (PubChem CID 6800682) has the molecular formula C15H18N6O4 and a molecular weight of 346.35 g/mol. Its IUPAC name is 1-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)hexane-2,3,4,5-tetrol.
| Compound Name | 1-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)hexane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 6800682 |
| Molecular Formula | C15H18N6O4 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)hexane-2,3,4,5-tetrol |
| SMILES | CC(O)C(O)C(O)C(O)C=NNc1nnc2c(n1)[nH]c1ccccc12 |
| InChI | InChI=1S/C15H18N6O4/c1-7(22)12(24)13(25)10(23)6-16-20-15-18-14-11(19-21-15)8-4-2-3-5-9(8)17-14/h2-7,10,12-13,22-25H,1H3,(H2,17,18,20,21) |
| InChIKey | SDXPXIQZDZNXLO-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 159.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|