About US8653087, III-13
US8653087, III-13 (PubChem CID 68035628) has the molecular formula C25H21ClF3N7O2
and a molecular weight of 543.90 g/mol. Its IUPAC name is 4-chloro-N-[4-methoxy-3-(trifluoromethyl)phenyl]-3-[(6-pyrrolidin-1-ylpyrimido[5,4-d]pyrimidin-4-yl)amino]benzamide.
Molecular Properties
| Compound Name | US8653087, III-13 |
| PubChem CID | 68035628 |
| Molecular Formula | C25H21ClF3N7O2 |
| Molecular Weight | 543.90 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | 4-chloro-N-[4-methoxy-3-(trifluoromethyl)phenyl]-3-[(6-pyrrolidin-1-ylpyrimido[5,4-d]pyrimidin-4-yl)amino]benzamide |
| SMILES | COC1=C(C=C(C=C1)NC(=O)C2=CC(=C(C=C2)Cl)NC3=NC=NC4=CN=C(N=C43)N5CCCC5)C(F)(F)F |
| InChI | InChI=1S/C25H21ClF3N7O2/c1-38-20-7-5-15(11-16(20)25(27,28)29)33-23(37)14-4-6-17(26)18(10-14)34-22-21-19(31-13-32-22)12-30-24(35-21)36-8-2-3-9-36/h4-7,10-13H,2-3,8-9H2,1H3,(H,33,37)(H,31,32,34) |
| InChIKey | IRQSZIVJQUOCKK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 105.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | 805 |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 543.90 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
Analyze US8653087, III-13 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US8653087, III-13?
The IUPAC name of US8653087, III-13 (CID 68035628) is 4-chloro-N-[4-methoxy-3-(trifluoromethyl)phenyl]-3-[(6-pyrrolidin-1-ylpyrimido[5,4-d]pyrimidin-4-yl)amino]benzamide.
What is the SMILES notation for US8653087, III-13?
The canonical SMILES for US8653087, III-13 is COC1=C(C=C(C=C1)NC(=O)C2=CC(=C(C=C2)Cl)NC3=NC=NC4=CN=C(N=C43)N5CCCC5)C(F)(F)F.
What is the InChIKey of US8653087, III-13?
The InChIKey is IRQSZIVJQUOCKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21ClF3N7O2/c1-38-20-7-5-15(11-16(20)25(27,28)29)33-23(37)14-4-6-17(26)18(10-14)34-22-21-19(31-13-32-22)12-30-24(35-21)36-8-2-3-9-36/h4-7,10-13H,2-3,8-9H2,1H3,(H,33,37)(H,31,32,34).
What are the key properties of US8653087, III-13?
US8653087, III-13 has a molecular weight of 543.90 g/mol, XLogP of 5.00, 6 rotatable bonds, 2 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for US8653087, III-13 is sourced from PubChem (CID 68035628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).