About 2,4-Diaminopyridine
2,4-Diaminopyridine (PubChem CID 68036) has the molecular formula C5H7N3
and a molecular weight of 109.13 g/mol. Its IUPAC name is pyridine-2,4-diamine.
Molecular Properties
| Compound Name | 2,4-Diaminopyridine |
| PubChem CID | 68036 |
| Molecular Formula | C5H7N3 |
| Molecular Weight | 109.13 g/mol |
| Exact Mass | 109.06 |
| IUPAC Name | pyridine-2,4-diamine |
| SMILES | C1=CN=C(C=C1N)N |
| InChI | InChI=1S/C5H7N3/c6-4-1-2-8-5(7)3-4/h1-3H,(H4,6,7,8) |
| InChIKey | IFFLKGMDBKQMAH-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 64.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | 74 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.13 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-Diaminopyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-Diaminopyridine?
The IUPAC name of 2,4-Diaminopyridine (CID 68036) is pyridine-2,4-diamine.
What is the SMILES notation for 2,4-Diaminopyridine?
The canonical SMILES for 2,4-Diaminopyridine is C1=CN=C(C=C1N)N.
What is the InChIKey of 2,4-Diaminopyridine?
The InChIKey is IFFLKGMDBKQMAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3/c6-4-1-2-8-5(7)3-4/h1-3H,(H4,6,7,8).
What are the key properties of 2,4-Diaminopyridine?
2,4-Diaminopyridine has a molecular weight of 109.13 g/mol, XLogP of -0.20, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-Diaminopyridine is sourced from PubChem (CID 68036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).