About 1-(4-nitrophenyl)-3,5-diphenylpyrazole
1-(4-nitrophenyl)-3,5-diphenylpyrazole (PubChem CID 680475) has the molecular formula C21H15N3O2
and a molecular weight of 341.37 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-3,5-diphenylpyrazole.
Molecular Properties
| Compound Name | 1-(4-nitrophenyl)-3,5-diphenylpyrazole |
| PubChem CID | 680475 |
| Molecular Formula | C21H15N3O2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 1-(4-nitrophenyl)-3,5-diphenylpyrazole |
| SMILES | O=[N+]([O-])c1ccc(-n2nc(-c3ccccc3)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H15N3O2/c25-24(26)19-13-11-18(12-14-19)23-21(17-9-5-2-6-10-17)15-20(22-23)16-7-3-1-4-8-16/h1-15H |
| InChIKey | PXCMBYXFVRQYSH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-nitrophenyl)-3,5-diphenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-nitrophenyl)-3,5-diphenylpyrazole?
The IUPAC name of 1-(4-nitrophenyl)-3,5-diphenylpyrazole (CID 680475) is 1-(4-nitrophenyl)-3,5-diphenylpyrazole.
What is the SMILES notation for 1-(4-nitrophenyl)-3,5-diphenylpyrazole?
The canonical SMILES for 1-(4-nitrophenyl)-3,5-diphenylpyrazole is O=[N+]([O-])c1ccc(-n2nc(-c3ccccc3)cc2-c2ccccc2)cc1.
What is the InChIKey of 1-(4-nitrophenyl)-3,5-diphenylpyrazole?
The InChIKey is PXCMBYXFVRQYSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15N3O2/c25-24(26)19-13-11-18(12-14-19)23-21(17-9-5-2-6-10-17)15-20(22-23)16-7-3-1-4-8-16/h1-15H.
What are the key properties of 1-(4-nitrophenyl)-3,5-diphenylpyrazole?
1-(4-nitrophenyl)-3,5-diphenylpyrazole has a molecular weight of 341.37 g/mol, XLogP of 5.11, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-nitrophenyl)-3,5-diphenylpyrazole is sourced from PubChem (CID 680475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).