About 2-hydroxy-3-nitrobenzoic acid
2-hydroxy-3-nitrobenzoic acid (PubChem CID 6807) has the molecular formula C7H5NO5
and a molecular weight of 183.12 g/mol. Its IUPAC name is 2-hydroxy-3-nitrobenzoic acid.
Molecular Properties
| Compound Name | 2-hydroxy-3-nitrobenzoic acid |
| PubChem CID | 6807 |
| Molecular Formula | C7H5NO5 |
| Molecular Weight | 183.12 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 2-hydroxy-3-nitrobenzoic acid |
| SMILES | O=C(O)c1cccc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C7H5NO5/c9-6-4(7(10)11)2-1-3-5(6)8(12)13/h1-3,9H,(H,10,11) |
| InChIKey | WWWFHFGUOIQNJC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.12 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-3-nitrobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3-nitrobenzoic acid?
The IUPAC name of 2-hydroxy-3-nitrobenzoic acid (CID 6807) is 2-hydroxy-3-nitrobenzoic acid.
What is the SMILES notation for 2-hydroxy-3-nitrobenzoic acid?
The canonical SMILES for 2-hydroxy-3-nitrobenzoic acid is O=C(O)c1cccc([N+](=O)[O-])c1O.
What is the InChIKey of 2-hydroxy-3-nitrobenzoic acid?
The InChIKey is WWWFHFGUOIQNJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO5/c9-6-4(7(10)11)2-1-3-5(6)8(12)13/h1-3,9H,(H,10,11).
What are the key properties of 2-hydroxy-3-nitrobenzoic acid?
2-hydroxy-3-nitrobenzoic acid has a molecular weight of 183.12 g/mol, XLogP of 1.00, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-nitrobenzoic acid is sourced from PubChem (CID 6807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).