C18H11N5O4S — CID 6808007
3-(4-nitrophenyl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)prop-2-enoic acid (PubChem CID 6808007) has the molecular formula C18H11N5O4S and a molecular weight of 393.38 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)prop-2-enoic acid.
| Compound Name | 3-(4-nitrophenyl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 6808007 |
| Molecular Formula | C18H11N5O4S |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 3-(4-nitrophenyl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)prop-2-enoic acid |
| SMILES | O=C(O)C(=Cc1ccc([N+](=O)[O-])cc1)Sc1nnc2c(n1)[nH]c1ccccc12 |
| InChI | InChI=1S/C18H11N5O4S/c24-17(25)14(9-10-5-7-11(8-6-10)23(26)27)28-18-20-16-15(21-22-18)12-3-1-2-4-13(12)19-16/h1-9H,(H,24,25)(H,19,20,22) |
| InChIKey | SLMUCHIREKLOJR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 134.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|