About Phthalimide
Phthalimide (PubChem CID 6809) has the molecular formula C8H5NO2
and a molecular weight of 147.13 g/mol. Its IUPAC name is isoindole-1,3-dione.
Molecular Properties
| Compound Name | Phthalimide |
| PubChem CID | 6809 |
| Molecular Formula | C8H5NO2 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.03 |
| IUPAC Name | isoindole-1,3-dione |
| SMILES | C1=CC=C2C(=C1)C(=O)NC2=O |
| InChI | InChI=1S/C8H5NO2/c10-7-5-3-1-2-4-6(5)8(11)9-7/h1-4H,(H,9,10,11) |
| InChIKey | XKJCHHZQLQNZHY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | 190 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze Phthalimide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Phthalimide?
The IUPAC name of Phthalimide (CID 6809) is isoindole-1,3-dione.
What is the SMILES notation for Phthalimide?
The canonical SMILES for Phthalimide is C1=CC=C2C(=C1)C(=O)NC2=O.
What is the InChIKey of Phthalimide?
The InChIKey is XKJCHHZQLQNZHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2/c10-7-5-3-1-2-4-6(5)8(11)9-7/h1-4H,(H,9,10,11).
What are the key properties of Phthalimide?
Phthalimide has a molecular weight of 147.13 g/mol, XLogP of 1.10, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Phthalimide is sourced from PubChem (CID 6809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).