About (2S)-N-[4-[(1R,5R)-2,5-dimethylcyclohex-2-en-1-yl]butyl]-N-ethylpentan-2-amine
(2S)-N-[4-[(1R,5R)-2,5-dimethylcyclohex-2-en-1-yl]butyl]-N-ethylpentan-2-amine (PubChem CID 68093722) has the molecular formula C19H37N
and a molecular weight of 279.50 g/mol. Its IUPAC name is (2S)-N-[4-[(1R,5R)-2,5-dimethylcyclohex-2-en-1-yl]butyl]-N-ethylpentan-2-amine.
Molecular Properties
| Compound Name | (2S)-N-[4-[(1R,5R)-2,5-dimethylcyclohex-2-en-1-yl]butyl]-N-ethylpentan-2-amine |
| PubChem CID | 68093722 |
| Molecular Formula | C19H37N |
| Molecular Weight | 279.50 g/mol |
| Exact Mass | 279.29 |
| IUPAC Name | (2S)-N-[4-[(1R,5R)-2,5-dimethylcyclohex-2-en-1-yl]butyl]-N-ethylpentan-2-amine |
| SMILES | CCC[C@H](C)N(CC)CCCC[C@@H]1C[C@@H](CC=C1C)C |
| InChI | InChI=1S/C19H37N/c1-6-10-18(5)20(7-2)14-9-8-11-19-15-16(3)12-13-17(19)4/h13,16,18-19H,6-12,14-15H2,1-5H3/t16-,18+,19-/m1/s1 |
| InChIKey | AQKKCHWAWKWTSH-NZSAHSFTSA-N |
| XLogP | 5.80 |
| TPSA | 3.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | 281 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 279.50 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N-[4-[(1R,5R)-2,5-dimethylcyclohex-2-en-1-yl]butyl]-N-ethylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-[4-[(1R,5R)-2,5-dimethylcyclohex-2-en-1-yl]butyl]-N-ethylpentan-2-amine?
The IUPAC name of (2S)-N-[4-[(1R,5R)-2,5-dimethylcyclohex-2-en-1-yl]butyl]-N-ethylpentan-2-amine (CID 68093722) is (2S)-N-[4-[(1R,5R)-2,5-dimethylcyclohex-2-en-1-yl]butyl]-N-ethylpentan-2-amine.
What is the SMILES notation for (2S)-N-[4-[(1R,5R)-2,5-dimethylcyclohex-2-en-1-yl]butyl]-N-ethylpentan-2-amine?
The canonical SMILES for (2S)-N-[4-[(1R,5R)-2,5-dimethylcyclohex-2-en-1-yl]butyl]-N-ethylpentan-2-amine is CCC[C@H](C)N(CC)CCCC[C@@H]1C[C@@H](CC=C1C)C.
What is the InChIKey of (2S)-N-[4-[(1R,5R)-2,5-dimethylcyclohex-2-en-1-yl]butyl]-N-ethylpentan-2-amine?
The InChIKey is AQKKCHWAWKWTSH-NZSAHSFTSA-N. The full InChI is InChI=1S/C19H37N/c1-6-10-18(5)20(7-2)14-9-8-11-19-15-16(3)12-13-17(19)4/h13,16,18-19H,6-12,14-15H2,1-5H3/t16-,18+,19-/m1/s1.
What are the key properties of (2S)-N-[4-[(1R,5R)-2,5-dimethylcyclohex-2-en-1-yl]butyl]-N-ethylpentan-2-amine?
(2S)-N-[4-[(1R,5R)-2,5-dimethylcyclohex-2-en-1-yl]butyl]-N-ethylpentan-2-amine has a molecular weight of 279.50 g/mol, XLogP of 5.80, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-[4-[(1R,5R)-2,5-dimethylcyclohex-2-en-1-yl]butyl]-N-ethylpentan-2-amine is sourced from PubChem (CID 68093722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).