About bis(6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one);palladium
bis(6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one);palladium (PubChem CID 6810799) has the molecular formula C18H22N2O2Pd
and a molecular weight of 404.81 g/mol. Its IUPAC name is bis(6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one);palladium.
Molecular Properties
| Compound Name | bis(6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one);palladium |
| PubChem CID | 6810799 |
| Molecular Formula | C18H22N2O2Pd |
| Molecular Weight | 404.81 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | bis(6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one);palladium |
| SMILES | CCNC=C1C=CC=CC1=O.CCNC=C1C=CC=CC1=O.[Pd] |
| InChI | InChI=1S/2C9H11NO.Pd/c2*1-2-10-7-8-5-3-4-6-9(8)11;/h2*3-7,10H,2H2,1H3; |
| InChIKey | SGSGEZAAYGBGAB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.81 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one);palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one);palladium?
The IUPAC name of bis(6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one);palladium (CID 6810799) is bis(6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one);palladium.
What is the SMILES notation for bis(6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one);palladium?
The canonical SMILES for bis(6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one);palladium is CCNC=C1C=CC=CC1=O.CCNC=C1C=CC=CC1=O.[Pd].
What is the InChIKey of bis(6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one);palladium?
The InChIKey is SGSGEZAAYGBGAB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H11NO.Pd/c2*1-2-10-7-8-5-3-4-6-9(8)11;/h2*3-7,10H,2H2,1H3;.
What are the key properties of bis(6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one);palladium?
bis(6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one);palladium has a molecular weight of 404.81 g/mol, XLogP of 2.35, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one);palladium is sourced from PubChem (CID 6810799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).