About 2-benzofuran-1,3-dione
2-benzofuran-1,3-dione (PubChem CID 6811) has the molecular formula C8H4O3
and a molecular weight of 148.12 g/mol. Its IUPAC name is 2-benzofuran-1,3-dione.
Molecular Properties
| Compound Name | 2-benzofuran-1,3-dione |
| PubChem CID | 6811 |
| Molecular Formula | C8H4O3 |
| Molecular Weight | 148.12 g/mol |
| Exact Mass | 148.02 |
| IUPAC Name | 2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C8H4O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1-4H |
| InChIKey | LGRFSURHDFAFJT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.12 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-benzofuran-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzofuran-1,3-dione?
The IUPAC name of 2-benzofuran-1,3-dione (CID 6811) is 2-benzofuran-1,3-dione.
What is the SMILES notation for 2-benzofuran-1,3-dione?
The canonical SMILES for 2-benzofuran-1,3-dione is O=C1OC(=O)c2ccccc21.
What is the InChIKey of 2-benzofuran-1,3-dione?
The InChIKey is LGRFSURHDFAFJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1-4H.
What are the key properties of 2-benzofuran-1,3-dione?
2-benzofuran-1,3-dione has a molecular weight of 148.12 g/mol, XLogP of 1.00, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzofuran-1,3-dione is sourced from PubChem (CID 6811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).