About Butyl 7a-methyl-7-methylidene-1,3-dioxo-3a,4-dihydroisoindole-2-carboxylate
Butyl 7a-methyl-7-methylidene-1,3-dioxo-3a,4-dihydroisoindole-2-carboxylate (PubChem CID 68132205) has the molecular formula C15H19NO4
and a molecular weight of 277.31 g/mol. Its IUPAC name is butyl 7a-methyl-7-methylidene-1,3-dioxo-3a,4-dihydroisoindole-2-carboxylate.
Molecular Properties
| Compound Name | Butyl 7a-methyl-7-methylidene-1,3-dioxo-3a,4-dihydroisoindole-2-carboxylate |
| PubChem CID | 68132205 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | butyl 7a-methyl-7-methylidene-1,3-dioxo-3a,4-dihydroisoindole-2-carboxylate |
| SMILES | CCCCOC(=O)N1C(=O)C2CC=CC(=C)C2(C1=O)C |
| InChI | InChI=1S/C15H19NO4/c1-4-5-9-20-14(19)16-12(17)11-8-6-7-10(2)15(11,3)13(16)18/h6-7,11H,2,4-5,8-9H2,1,3H3 |
| InChIKey | VHAOXFRPWSFDBL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | 508 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze Butyl 7a-methyl-7-methylidene-1,3-dioxo-3a,4-dihydroisoindole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Butyl 7a-methyl-7-methylidene-1,3-dioxo-3a,4-dihydroisoindole-2-carboxylate?
The IUPAC name of Butyl 7a-methyl-7-methylidene-1,3-dioxo-3a,4-dihydroisoindole-2-carboxylate (CID 68132205) is butyl 7a-methyl-7-methylidene-1,3-dioxo-3a,4-dihydroisoindole-2-carboxylate.
What is the SMILES notation for Butyl 7a-methyl-7-methylidene-1,3-dioxo-3a,4-dihydroisoindole-2-carboxylate?
The canonical SMILES for Butyl 7a-methyl-7-methylidene-1,3-dioxo-3a,4-dihydroisoindole-2-carboxylate is CCCCOC(=O)N1C(=O)C2CC=CC(=C)C2(C1=O)C.
What is the InChIKey of Butyl 7a-methyl-7-methylidene-1,3-dioxo-3a,4-dihydroisoindole-2-carboxylate?
The InChIKey is VHAOXFRPWSFDBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO4/c1-4-5-9-20-14(19)16-12(17)11-8-6-7-10(2)15(11,3)13(16)18/h6-7,11H,2,4-5,8-9H2,1,3H3.
What are the key properties of Butyl 7a-methyl-7-methylidene-1,3-dioxo-3a,4-dihydroisoindole-2-carboxylate?
Butyl 7a-methyl-7-methylidene-1,3-dioxo-3a,4-dihydroisoindole-2-carboxylate has a molecular weight of 277.31 g/mol, XLogP of 2.30, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Butyl 7a-methyl-7-methylidene-1,3-dioxo-3a,4-dihydroisoindole-2-carboxylate is sourced from PubChem (CID 68132205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).