About bis(6-[(butan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one);copper
bis(6-[(butan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one);copper (PubChem CID 6813240) has the molecular formula C22H30CuN2O2
and a molecular weight of 418.04 g/mol. Its IUPAC name is bis(6-[(butan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one);copper.
Molecular Properties
| Compound Name | bis(6-[(butan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one);copper |
| PubChem CID | 6813240 |
| Molecular Formula | C22H30CuN2O2 |
| Molecular Weight | 418.04 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | bis(6-[(butan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one);copper |
| SMILES | CCC(C)NC=C1C=CC=CC1=O.CCC(C)NC=C1C=CC=CC1=O.[Cu] |
| InChI | InChI=1S/2C11H15NO.Cu/c2*1-3-9(2)12-8-10-6-4-5-7-11(10)13;/h2*4-9,12H,3H2,1-2H3; |
| InChIKey | DKSBKOSYJWHCGM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.04 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(6-[(butan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one);copper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(6-[(butan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one);copper?
The IUPAC name of bis(6-[(butan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one);copper (CID 6813240) is bis(6-[(butan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one);copper.
What is the SMILES notation for bis(6-[(butan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one);copper?
The canonical SMILES for bis(6-[(butan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one);copper is CCC(C)NC=C1C=CC=CC1=O.CCC(C)NC=C1C=CC=CC1=O.[Cu].
What is the InChIKey of bis(6-[(butan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one);copper?
The InChIKey is DKSBKOSYJWHCGM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H15NO.Cu/c2*1-3-9(2)12-8-10-6-4-5-7-11(10)13;/h2*4-9,12H,3H2,1-2H3;.
What are the key properties of bis(6-[(butan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one);copper?
bis(6-[(butan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one);copper has a molecular weight of 418.04 g/mol, XLogP of 3.90, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(6-[(butan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one);copper is sourced from PubChem (CID 6813240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).